C21H13FN4O2S — CID 162117308
2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]benzoic acid (PubChem CID 162117308) has the molecular formula C21H13FN4O2S and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]benzoic acid.
| Compound Name | 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 162117308 |
| Molecular Formula | C21H13FN4O2S |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-fluoro-4-[3-(4-isocyano-3-methylphenyl)-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]benzoic acid |
| SMILES | [C-]#[N+]c1ccc(-n2c(=S)n(-c3ccc(C(=O)O)c(F)c3)c3cccnc32)cc1C |
| InChI | InChI=1S/C21H13FN4O2S/c1-12-10-13(6-8-17(12)23-2)26-19-18(4-3-9-24-19)25(21(26)29)14-5-7-15(20(27)28)16(22)11-14/h3-11H,1H3,(H,27,28) |
| InChIKey | JDWSZEVXNLYXNW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|