C23H15F4N5OS — CID 155606055
2-fluoro-4-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-7-methyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]-N-methylbenzamide (PubChem CID 155606055) has the molecular formula C23H15F4N5OS and a molecular weight of 485.47 g/mol. Its IUPAC name is 2-fluoro-4-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-7-methyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]-N-methylbenzamide.
| Compound Name | 2-fluoro-4-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-7-methyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155606055 |
| Molecular Formula | C23H15F4N5OS |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 2-fluoro-4-[3-[4-isocyano-3-(trifluoromethyl)phenyl]-7-methyl-2-sulfanylideneimidazo[4,5-b]pyridin-1-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(-n2c(=S)n(-c3ccc(C(=O)NC)c(F)c3)c3c(C)ccnc32)cc1C(F)(F)F |
| InChI | InChI=1S/C23H15F4N5OS/c1-12-8-9-30-20-19(12)31(14-4-6-15(17(24)11-14)21(33)29-3)22(34)32(20)13-5-7-18(28-2)16(10-13)23(25,26)27/h4-11H,1,3H3,(H,29,33) |
| InChIKey | QQGOKRUHKZXTTR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|