C26H33N5O4 — CID 162160449
N-[(3-methoxyphenyl)methyl]-1-[4-[4-(4-methyl-2-oxopentyl)-2-oxo-1-pyridinyl]butyl]triazole-4-carboxamide (PubChem CID 162160449) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-1-[4-[4-(4-methyl-2-oxopentyl)-2-oxo-1-pyridinyl]butyl]triazole-4-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-1-[4-[4-(4-methyl-2-oxopentyl)-2-oxo-1-pyridinyl]butyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 162160449 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-1-[4-[4-(4-methyl-2-oxopentyl)-2-oxo-1-pyridinyl]butyl]triazole-4-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cn(CCCCn3ccc(CC(=O)CC(C)C)cc3=O)nn2)c1 |
| InChI | InChI=1S/C26H33N5O4/c1-19(2)13-22(32)14-20-9-12-30(25(33)16-20)10-4-5-11-31-18-24(28-29-31)26(34)27-17-21-7-6-8-23(15-21)35-3/h6-9,12,15-16,18-19H,4-5,10-11,13-14,17H2,1-3H3,(H,27,34) |
| InChIKey | ZMKDQQFQHCEUSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|