C34H39N9O6 — CID 162180164
4-methyl-5-nitro-1H-indazole;4-methyl-5-nitro-1-(oxan-2-yl)indazole;4-methyl-1-(oxan-2-yl)indazol-5-amine (PubChem CID 162180164) has the molecular formula C34H39N9O6 and a molecular weight of 669.74 g/mol. Its IUPAC name is 4-methyl-5-nitro-1H-indazole;4-methyl-5-nitro-1-(oxan-2-yl)indazole;4-methyl-1-(oxan-2-yl)indazol-5-amine.
| Compound Name | 4-methyl-5-nitro-1H-indazole;4-methyl-5-nitro-1-(oxan-2-yl)indazole;4-methyl-1-(oxan-2-yl)indazol-5-amine |
|---|---|
| PubChem CID | 162180164 |
| Molecular Formula | C34H39N9O6 |
| Molecular Weight | 669.74 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 4-methyl-5-nitro-1H-indazole;4-methyl-5-nitro-1-(oxan-2-yl)indazole;4-methyl-1-(oxan-2-yl)indazol-5-amine |
| SMILES | Cc1c(N)ccc2c1cnn2C1CCCCO1.Cc1c([N+](=O)[O-])ccc2[nH]ncc12.Cc1c([N+](=O)[O-])ccc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C13H15N3O3.C13H17N3O.C8H7N3O2/c1-9-10-8-14-15(13-4-2-3-7-19-13)12(10)6-5-11(9)16(17)18;1-9-10-8-15-16(12(10)6-5-11(9)14)13-4-2-3-7-17-13;1-5-6-4-9-10-7(6)2-3-8(5)11(12)13/h5-6,8,13H,2-4,7H2,1H3;5-6,8,13H,2-4,7,14H2,1H3;2-4H,1H3,(H,9,10) |
| InChIKey | ZOXJQFLVZUCQRJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|