C9H17BF2O5 — CID 162200906
CID 162200906 (PubChem CID 162200906) has the molecular formula C9H17BF2O5 and a molecular weight of 254.04 g/mol.
| Compound Name | CID 162200906 |
|---|---|
| PubChem CID | 162200906 |
| Molecular Formula | C9H17BF2O5 |
| Molecular Weight | 254.04 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | — |
| SMILES | [B]C(F)(F)COCC(COC)OCC(O)CO |
| InChI | InChI=1S/C9H17BF2O5/c1-15-4-8(17-3-7(14)2-13)5-16-6-9(10,11)12/h7-8,13-14H,2-6H2,1H3 |
| InChIKey | FMXLGIGBWHTAAS-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.04 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|