C26H24N2V2+2 — CID 162211345
1,6-dimethyl-3-phenyl-2H-pyridin-1-ium-2-ide;1,6-dimethyl-4-phenyl-3H-pyridin-1-ium-3-ide;bis(vanadium(2+)) (PubChem CID 162211345) has the molecular formula C26H24N2V2+2 and a molecular weight of 466.38 g/mol. Its IUPAC name is 1,6-dimethyl-3-phenyl-2H-pyridin-1-ium-2-ide;1,6-dimethyl-4-phenyl-3H-pyridin-1-ium-3-ide;bis(vanadium(2+)).
| Compound Name | 1,6-dimethyl-3-phenyl-2H-pyridin-1-ium-2-ide;1,6-dimethyl-4-phenyl-3H-pyridin-1-ium-3-ide;bis(vanadium(2+)) |
|---|---|
| PubChem CID | 162211345 |
| Molecular Formula | C26H24N2V2+2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 1,6-dimethyl-3-phenyl-2H-pyridin-1-ium-2-ide;1,6-dimethyl-4-phenyl-3H-pyridin-1-ium-3-ide;bis(vanadium(2+)) |
| SMILES | Cc1cc(-c2[c-]cccc2)[c-]c[n+]1C.Cc1ccc(-c2[c-]cccc2)[c-][n+]1C.[V+2].[V+2] |
| InChI | InChI=1S/2C13H12N.2V/c1-11-10-13(8-9-14(11)2)12-6-4-3-5-7-12;1-11-8-9-13(10-14(11)2)12-6-4-3-5-7-12;;/h3-6,9-10H,1-2H3;3-6,8-9H,1-2H3;;/q2*-1;2*+2 |
| InChIKey | KTLORMAHTGMHDG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|