C41H62N2O10 — CID 162219700
tert-butyl (2S)-6-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate;tert-butyl (2S)-2-(phenylmethoxycarbonylamino)hex-5-enoate;2-methyloxolane (PubChem CID 162219700) has the molecular formula C41H62N2O10 and a molecular weight of 742.95 g/mol. Its IUPAC name is tert-butyl (2S)-6-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate;tert-butyl (2S)-2-(phenylmethoxycarbonylamino)hex-5-enoate;2-methyloxolane.
| Compound Name | tert-butyl (2S)-6-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate;tert-butyl (2S)-2-(phenylmethoxycarbonylamino)hex-5-enoate;2-methyloxolane |
|---|---|
| PubChem CID | 162219700 |
| Molecular Formula | C41H62N2O10 |
| Molecular Weight | 742.95 g/mol |
| Exact Mass | 742.44 |
| IUPAC Name | tert-butyl (2S)-6-hydroxy-2-(phenylmethoxycarbonylamino)hexanoate;tert-butyl (2S)-2-(phenylmethoxycarbonylamino)hex-5-enoate;2-methyloxolane |
| SMILES | C=CCC[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)[C@H](CCCCO)NC(=O)OCc1ccccc1.CC1CCCO1 |
| InChI | InChI=1S/C18H27NO5.C18H25NO4.C5H10O/c1-18(2,3)24-16(21)15(11-7-8-12-20)19-17(22)23-13-14-9-5-4-6-10-14;1-5-6-12-15(16(20)23-18(2,3)4)19-17(21)22-13-14-10-8-7-9-11-14;1-5-3-2-4-6-5/h4-6,9-10,15,20H,7-8,11-13H2,1-3H3,(H,19,22);5,7-11,15H,1,6,12-13H2,2-4H3,(H,19,21);5H,2-4H2,1H3/t2*15-;/m00./s1 |
| InChIKey | ZTYKGKLOSDHEBR-ZFQYHYQMSA-N |
| XLogP | 7.56 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.95 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|