C15H12N2O4S2 — CID 162226373
7-amino-4H-1,4-benzoxazin-3-one;thieno[3,2-b]thiophene-5-carboxylic acid (PubChem CID 162226373) has the molecular formula C15H12N2O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 7-amino-4H-1,4-benzoxazin-3-one;thieno[3,2-b]thiophene-5-carboxylic acid.
| Compound Name | 7-amino-4H-1,4-benzoxazin-3-one;thieno[3,2-b]thiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 162226373 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 7-amino-4H-1,4-benzoxazin-3-one;thieno[3,2-b]thiophene-5-carboxylic acid |
| SMILES | Nc1ccc2c(c1)OCC(=O)N2.O=C(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C8H8N2O2.C7H4O2S2/c9-5-1-2-6-7(3-5)12-4-8(11)10-6;8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,4,9H2,(H,10,11);1-3H,(H,8,9) |
| InChIKey | ZUUYKNDKSHYCIP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|