C46H62N4O12S2 — CID 162239121
2-ethylhexyl 3-[(6-amino-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate;2-ethylhexyl 3-[(6-nitro-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate (PubChem CID 162239121) has the molecular formula C46H62N4O12S2 and a molecular weight of 927.15 g/mol. Its IUPAC name is 2-ethylhexyl 3-[(6-amino-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate;2-ethylhexyl 3-[(6-nitro-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[(6-amino-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate;2-ethylhexyl 3-[(6-nitro-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate |
|---|---|
| PubChem CID | 162239121 |
| Molecular Formula | C46H62N4O12S2 |
| Molecular Weight | 927.15 g/mol |
| Exact Mass | 926.38 |
| IUPAC Name | 2-ethylhexyl 3-[(6-amino-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate;2-ethylhexyl 3-[(6-nitro-5-phenylmethoxy-2-pyridinyl)sulfonyl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCS(=O)(=O)c1ccc(OCc2ccccc2)c(N)n1.CCCCC(CC)COC(=O)CCS(=O)(=O)c1ccc(OCc2ccccc2)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H30N2O7S.C23H32N2O5S/c1-3-5-9-18(4-2)16-32-22(26)14-15-33(29,30)21-13-12-20(23(24-21)25(27)28)31-17-19-10-7-6-8-11-19;1-3-5-9-18(4-2)16-30-22(26)14-15-31(27,28)21-13-12-20(23(24)25-21)29-17-19-10-7-6-8-11-19/h6-8,10-13,18H,3-5,9,14-17H2,1-2H3;6-8,10-13,18H,3-5,9,14-17H2,1-2H3,(H2,24,25) |
| InChIKey | ZWLRXSAWHCIFMM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 234.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.15 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|