C23H32N2O5S — CID 153335696
2-ethylhexyl 3-[[5-(cyclohexa-1,5-dien-1-ylmethoxy)-6-nitro-2-pyridinyl]sulfanyl]propanoate (PubChem CID 153335696) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-ethylhexyl 3-[[5-(cyclohexa-1,5-dien-1-ylmethoxy)-6-nitro-2-pyridinyl]sulfanyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[[5-(cyclohexa-1,5-dien-1-ylmethoxy)-6-nitro-2-pyridinyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 153335696 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-ethylhexyl 3-[[5-(cyclohexa-1,5-dien-1-ylmethoxy)-6-nitro-2-pyridinyl]sulfanyl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(OCC2=CCCC=C2)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H32N2O5S/c1-3-5-9-18(4-2)16-30-22(26)14-15-31-21-13-12-20(23(24-21)25(27)28)29-17-19-10-7-6-8-11-19/h7,10-13,18H,3-6,8-9,14-17H2,1-2H3 |
| InChIKey | JLQOANRUNGHTBI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|