C16H25ClN2O3S2 — CID 162258175
2-chloroacetaldehyde;oxane-4-carbothioamide;2-(oxan-4-yl)-1,3-thiazole (PubChem CID 162258175) has the molecular formula C16H25ClN2O3S2 and a molecular weight of 392.97 g/mol. Its IUPAC name is 2-chloroacetaldehyde;oxane-4-carbothioamide;2-(oxan-4-yl)-1,3-thiazole.
| Compound Name | 2-chloroacetaldehyde;oxane-4-carbothioamide;2-(oxan-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 162258175 |
| Molecular Formula | C16H25ClN2O3S2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-chloroacetaldehyde;oxane-4-carbothioamide;2-(oxan-4-yl)-1,3-thiazole |
| SMILES | NC(=S)C1CCOCC1.O=CCCl.c1csc(C2CCOCC2)n1 |
| InChI | InChI=1S/C8H11NOS.C6H11NOS.C2H3ClO/c1-4-10-5-2-7(1)8-9-3-6-11-8;7-6(9)5-1-3-8-4-2-5;3-1-2-4/h3,6-7H,1-2,4-5H2;5H,1-4H2,(H2,7,9);2H,1H2 |
| InChIKey | ZYWIZGXXTZBGTE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|