C22H23P — CID 162273744
[(2R)-2-[(1S)-cyclopent-2-en-1-yl]cyclopent-3-en-1-yl]-diphenylphosphane (PubChem CID 162273744) has the molecular formula C22H23P and a molecular weight of 318.40 g/mol. Its IUPAC name is [(2R)-2-[(1S)-cyclopent-2-en-1-yl]cyclopent-3-en-1-yl]-diphenylphosphane.
| Compound Name | [(2R)-2-[(1S)-cyclopent-2-en-1-yl]cyclopent-3-en-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 162273744 |
| Molecular Formula | C22H23P |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2R)-2-[(1S)-cyclopent-2-en-1-yl]cyclopent-3-en-1-yl]-diphenylphosphane |
| SMILES | C1=C[C@@H]([C@H]2C=CCC2P(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H23P/c1-3-12-19(13-4-1)23(20-14-5-2-6-15-20)22-17-9-16-21(22)18-10-7-8-11-18/h1-7,9-10,12-16,18,21-22H,8,11,17H2/t18-,21-,22?/m1/s1 |
| InChIKey | FWQNAUVSMJTURY-QOCBGMSTSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|