C34H45N7O9 — CID 162278130
(2R,8R)-8-[[(2S)-2-amino-5-[(3-amino-3-iminopropyl)amino]pentanoyl]amino]-2-(3-carboxypropanoylamino)-10-(1,3-dioxobenzo[de]isoquinolin-2-yl)-7-oxodecanoic acid (PubChem CID 162278130) has the molecular formula C34H45N7O9 and a molecular weight of 695.77 g/mol. Its IUPAC name is (2R,8R)-8-[[(2S)-2-amino-5-[(3-amino-3-iminopropyl)amino]pentanoyl]amino]-2-(3-carboxypropanoylamino)-10-(1,3-dioxobenzo[de]isoquinolin-2-yl)-7-oxodecanoic acid.
| Compound Name | (2R,8R)-8-[[(2S)-2-amino-5-[(3-amino-3-iminopropyl)amino]pentanoyl]amino]-2-(3-carboxypropanoylamino)-10-(1,3-dioxobenzo[de]isoquinolin-2-yl)-7-oxodecanoic acid |
|---|---|
| PubChem CID | 162278130 |
| Molecular Formula | C34H45N7O9 |
| Molecular Weight | 695.77 g/mol |
| Exact Mass | 695.33 |
| IUPAC Name | (2R,8R)-8-[[(2S)-2-amino-5-[(3-amino-3-iminopropyl)amino]pentanoyl]amino]-2-(3-carboxypropanoylamino)-10-(1,3-dioxobenzo[de]isoquinolin-2-yl)-7-oxodecanoic acid |
| SMILES | [H]/N=C(\N)CCNCCC[C@H](N)C(=O)N[C@H](CCN1C(=O)c2cccc3cccc(c23)C1=O)C(=O)CCCC[C@@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H45N7O9/c35-23(10-5-17-38-18-15-27(36)37)31(46)40-24(26(42)12-2-1-11-25(34(49)50)39-28(43)13-14-29(44)45)16-19-41-32(47)21-8-3-6-20-7-4-9-22(30(20)21)33(41)48/h3-4,6-9,23-25,38H,1-2,5,10-19,35H2,(H3,36,37)(H,39,43)(H,40,46)(H,44,45)(H,49,50)/t23-,24+,25+/m0/s1 |
| InChIKey | HVCLGNBEUZBTRV-ISJGIBHGSA-N |
| XLogP | 0.90 |
| TPSA | 275.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.77 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|