C22H42Zr — CID 162298132
carbanide;1-(1-cyclopentylcyclobutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;zirconium(4+) (PubChem CID 162298132) has the molecular formula C22H42Zr and a molecular weight of 397.80 g/mol. Its IUPAC name is carbanide;1-(1-cyclopentylcyclobutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;zirconium(4+).
| Compound Name | carbanide;1-(1-cyclopentylcyclobutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;zirconium(4+) |
|---|---|
| PubChem CID | 162298132 |
| Molecular Formula | C22H42Zr |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | carbanide;1-(1-cyclopentylcyclobutyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;zirconium(4+) |
| SMILES | C1CCC2C(C1)CCC2C1(C2CCCC2)CCC1.[CH3-].[CH3-].[CH3-].[CH3-].[Zr+4] |
| InChI | InChI=1S/C18H30.4CH3.Zr/c1-4-9-16-14(6-1)10-11-17(16)18(12-5-13-18)15-7-2-3-8-15;;;;;/h14-17H,1-13H2;4*1H3;/q;4*-1;+4 |
| InChIKey | CDYCAKVJWCYKHG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|