C16H28O2 — CID 176883882
8,8-dimethoxy-2,3,4,4a,4b,5,6,7,8a,9,10,10a-dodecahydro-1H-phenanthrene (PubChem CID 176883882) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 8,8-dimethoxy-2,3,4,4a,4b,5,6,7,8a,9,10,10a-dodecahydro-1H-phenanthrene.
| Compound Name | 8,8-dimethoxy-2,3,4,4a,4b,5,6,7,8a,9,10,10a-dodecahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 176883882 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 8,8-dimethoxy-2,3,4,4a,4b,5,6,7,8a,9,10,10a-dodecahydro-1H-phenanthrene |
| SMILES | COC1(OC)CCCC2C3CCCCC3CCC21 |
| InChI | InChI=1S/C16H28O2/c1-17-16(18-2)11-5-8-14-13-7-4-3-6-12(13)9-10-15(14)16/h12-15H,3-11H2,1-2H3 |
| InChIKey | CDBGOKHPUWKPAU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|