C31H36ClN5O4 — CID 162319925
ethyl 4-[(E)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethenyl]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzoate;hydrochloride (PubChem CID 162319925) has the molecular formula C31H36ClN5O4 and a molecular weight of 578.11 g/mol. Its IUPAC name is ethyl 4-[(E)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethenyl]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzoate;hydrochloride.
| Compound Name | ethyl 4-[(E)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethenyl]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 162319925 |
| Molecular Formula | C31H36ClN5O4 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | ethyl 4-[(E)-2-[3-(N'-hydroxycarbamimidoyl)phenyl]ethenyl]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(/C=C/c2cccc(C(N)=NO)c2)c(NC(=O)c2ccc(N3CCCN(C)CC3)cc2)c1.Cl |
| InChI | InChI=1S/C31H35N5O4.ClH/c1-3-40-31(38)26-11-10-23(9-8-22-6-4-7-25(20-22)29(32)34-39)28(21-26)33-30(37)24-12-14-27(15-13-24)36-17-5-16-35(2)18-19-36;/h4,6-15,20-21,39H,3,5,16-19H2,1-2H3,(H2,32,34)(H,33,37);1H/b9-8+; |
| InChIKey | ONMKBDCUPDYNGZ-HRNDJLQDSA-N |
| XLogP | 4.94 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|