C24H27N3O3S — CID 162346516
[2-methyl-6-oxo-5-(4-prop-2-enylphenyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexan-2-yl] carbamate (PubChem CID 162346516) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is [2-methyl-6-oxo-5-(4-prop-2-enylphenyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexan-2-yl] carbamate.
| Compound Name | [2-methyl-6-oxo-5-(4-prop-2-enylphenyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexan-2-yl] carbamate |
|---|---|
| PubChem CID | 162346516 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | [2-methyl-6-oxo-5-(4-prop-2-enylphenyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexan-2-yl] carbamate |
| SMILES | C=CCc1ccc(C(CCC(C)(C)OC(N)=O)C(=O)Nc2cc3ccncc3s2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-4-5-16-6-8-17(9-7-16)19(10-12-24(2,3)30-23(25)29)22(28)27-21-14-18-11-13-26-15-20(18)31-21/h4,6-9,11,13-15,19H,1,5,10,12H2,2-3H3,(H2,25,29)(H,27,28) |
| InChIKey | LFJIHJSJAWGSQY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|