C17H16N4O4S — CID 166791622
[4-[3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl nitrate (PubChem CID 166791622) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is [4-[3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl nitrate.
| Compound Name | [4-[3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 166791622 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [4-[3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl nitrate |
| SMILES | NCC(C(=O)Nc1cc2ccncc2s1)c1ccc(CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N4O4S/c18-8-14(12-3-1-11(2-4-12)10-25-21(23)24)17(22)20-16-7-13-5-6-19-9-15(13)26-16/h1-7,9,14H,8,10,18H2,(H,20,22) |
| InChIKey | MOIMMNDSTBCFSN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|