C20H19N5O10S — CID 166791612
[2-[4-(1,3-dinitrooxypropan-2-yloxy)phenyl]-3-oxo-3-(thieno[2,3-c]pyridin-2-ylamino)propyl]carbamic acid (PubChem CID 166791612) has the molecular formula C20H19N5O10S and a molecular weight of 521.46 g/mol. Its IUPAC name is [2-[4-(1,3-dinitrooxypropan-2-yloxy)phenyl]-3-oxo-3-(thieno[2,3-c]pyridin-2-ylamino)propyl]carbamic acid.
| Compound Name | [2-[4-(1,3-dinitrooxypropan-2-yloxy)phenyl]-3-oxo-3-(thieno[2,3-c]pyridin-2-ylamino)propyl]carbamic acid |
|---|---|
| PubChem CID | 166791612 |
| Molecular Formula | C20H19N5O10S |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | [2-[4-(1,3-dinitrooxypropan-2-yloxy)phenyl]-3-oxo-3-(thieno[2,3-c]pyridin-2-ylamino)propyl]carbamic acid |
| SMILES | O=C(O)NCC(C(=O)Nc1cc2ccncc2s1)c1ccc(OC(CO[N+](=O)[O-])CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N5O10S/c26-19(23-18-7-13-5-6-21-9-17(13)36-18)16(8-22-20(27)28)12-1-3-14(4-2-12)35-15(10-33-24(29)30)11-34-25(31)32/h1-7,9,15-16,22H,8,10-11H2,(H,23,26)(H,27,28) |
| InChIKey | RNJQEXZNNSWULX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 205.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|