C22H24N4O6S — CID 162346490
[4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 5-nitrooxypentanoate (PubChem CID 162346490) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 5-nitrooxypentanoate.
| Compound Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 5-nitrooxypentanoate |
|---|---|
| PubChem CID | 162346490 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 5-nitrooxypentanoate |
| SMILES | NC[C@@H](C(=O)Nc1cc2ccncc2s1)c1ccc(COC(=O)CCCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N4O6S/c23-12-18(22(28)25-20-11-17-8-9-24-13-19(17)33-20)16-6-4-15(5-7-16)14-31-21(27)3-1-2-10-32-26(29)30/h4-9,11,13,18H,1-3,10,12,14,23H2,(H,25,28)/t18-/m1/s1 |
| InChIKey | MKWQHHHEKLRVKD-GOSISDBHSA-N |
| XLogP | 3.40 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|