C23H28N4O6S — CID 162390438
benzyl (4S,5S,6S)-5-(aminomethyl)-6-hydroxy-4-(2-nitrooxyethyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexanoate (PubChem CID 162390438) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is benzyl (4S,5S,6S)-5-(aminomethyl)-6-hydroxy-4-(2-nitrooxyethyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexanoate.
| Compound Name | benzyl (4S,5S,6S)-5-(aminomethyl)-6-hydroxy-4-(2-nitrooxyethyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexanoate |
|---|---|
| PubChem CID | 162390438 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | benzyl (4S,5S,6S)-5-(aminomethyl)-6-hydroxy-4-(2-nitrooxyethyl)-6-(thieno[2,3-c]pyridin-2-ylamino)hexanoate |
| SMILES | NC[C@H]([C@H](CCO[N+](=O)[O-])CCC(=O)OCc1ccccc1)[C@H](O)Nc1cc2ccncc2s1 |
| InChI | InChI=1S/C23H28N4O6S/c24-13-19(23(29)26-21-12-18-8-10-25-14-20(18)34-21)17(9-11-33-27(30)31)6-7-22(28)32-15-16-4-2-1-3-5-16/h1-5,8,10,12,14,17,19,23,26,29H,6-7,9,11,13,15,24H2/t17-,19+,23-/m0/s1 |
| InChIKey | QDDJCNCUQXRHLH-GWJPWWOOSA-N |
| XLogP | 3.34 |
| TPSA | 149.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|