C26H24N4O6S — CID 175023713
benzyl 4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]-3-(2-nitrooxyethyl)benzoate (PubChem CID 175023713) has the molecular formula C26H24N4O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is benzyl 4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]-3-(2-nitrooxyethyl)benzoate.
| Compound Name | benzyl 4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]-3-(2-nitrooxyethyl)benzoate |
|---|---|
| PubChem CID | 175023713 |
| Molecular Formula | C26H24N4O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | benzyl 4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]-3-(2-nitrooxyethyl)benzoate |
| SMILES | NC[C@@H](C(=O)Nc1cc2ccncc2s1)c1ccc(C(=O)OCc2ccccc2)cc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N4O6S/c27-14-22(25(31)29-24-13-19-8-10-28-15-23(19)37-24)21-7-6-20(12-18(21)9-11-36-30(33)34)26(32)35-16-17-4-2-1-3-5-17/h1-8,10,12-13,15,22H,9,11,14,16,27H2,(H,29,31)/t22-/m1/s1 |
| InChIKey | UFTQPGMVKNOCLJ-JOCHJYFZSA-N |
| XLogP | 4.09 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|