C22H20N4O6S — CID 166791646
[4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl (3S)-3-nitrooxycyclobutene-1-carboxylate (PubChem CID 166791646) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl (3S)-3-nitrooxycyclobutene-1-carboxylate.
| Compound Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl (3S)-3-nitrooxycyclobutene-1-carboxylate |
|---|---|
| PubChem CID | 166791646 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl (3S)-3-nitrooxycyclobutene-1-carboxylate |
| SMILES | NC[C@@H](C(=O)Nc1cc2ccncc2s1)c1ccc(COC(=O)C2=C[C@@H](O[N+](=O)[O-])C2)cc1 |
| InChI | InChI=1S/C22H20N4O6S/c23-10-18(21(27)25-20-9-15-5-6-24-11-19(15)33-20)14-3-1-13(2-4-14)12-31-22(28)16-7-17(8-16)32-26(29)30/h1-7,9,11,17-18H,8,10,12,23H2,(H,25,27)/t17-,18-/m1/s1 |
| InChIKey | AZALXDWVTKDRAX-QZTJIDSGSA-N |
| XLogP | 2.93 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|