C16H16N4O4S — CID 175026341
3-amino-2-phenyl-N-thieno[2,3-c]pyridin-2-ylpropanamide;nitric acid (PubChem CID 175026341) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 3-amino-2-phenyl-N-thieno[2,3-c]pyridin-2-ylpropanamide;nitric acid.
| Compound Name | 3-amino-2-phenyl-N-thieno[2,3-c]pyridin-2-ylpropanamide;nitric acid |
|---|---|
| PubChem CID | 175026341 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-amino-2-phenyl-N-thieno[2,3-c]pyridin-2-ylpropanamide;nitric acid |
| SMILES | NCC(C(=O)Nc1cc2ccncc2s1)c1ccccc1.O=[N+]([O-])O |
| InChI | InChI=1S/C16H15N3OS.HNO3/c17-9-13(11-4-2-1-3-5-11)16(20)19-15-8-12-6-7-18-10-14(12)21-15;2-1(3)4/h1-8,10,13H,9,17H2,(H,19,20);(H,2,3,4) |
| InChIKey | FYFHIAQGVMIDRW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|