C23H26N4O6S — CID 166005062
[4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 6-nitrooxyhexanoate (PubChem CID 166005062) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 6-nitrooxyhexanoate.
| Compound Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 6-nitrooxyhexanoate |
|---|---|
| PubChem CID | 166005062 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | [4-[(2S)-3-amino-1-oxo-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 6-nitrooxyhexanoate |
| SMILES | NC[C@@H](C(=O)Nc1cc2ccncc2s1)c1ccc(COC(=O)CCCCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H26N4O6S/c24-13-19(23(29)26-21-12-18-9-10-25-14-20(18)34-21)17-7-5-16(6-8-17)15-32-22(28)4-2-1-3-11-33-27(30)31/h5-10,12,14,19H,1-4,11,13,15,24H2,(H,26,29)/t19-/m1/s1 |
| InChIKey | QXLUWQKOSDGTKS-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|