About [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate
[4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate (PubChem CID 166810795) has the molecular formula C25H21N3O6S
and a molecular weight of 491.53 g/mol. Its IUPAC name is [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate.
Molecular Properties
| Compound Name | [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate |
| PubChem CID | 166810795 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate |
| SMILES | O=C(Cc1ccc(COC(=O)c2cccc(CCO[N+](=O)[O-])c2)cc1)Nc1cc2ccncc2s1 |
| InChI | InChI=1S/C25H21N3O6S/c29-23(27-24-14-20-8-10-26-15-22(20)35-24)13-18-4-6-19(7-5-18)16-33-25(30)21-3-1-2-17(12-21)9-11-34-28(31)32/h1-8,10,12,14-15H,9,11,13,16H2,(H,27,29) |
| InChIKey | LBRVLUOTHLSLDH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate?
The IUPAC name of [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate (CID 166810795) is [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate.
What is the SMILES notation for [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate?
The canonical SMILES for [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate is O=C(Cc1ccc(COC(=O)c2cccc(CCO[N+](=O)[O-])c2)cc1)Nc1cc2ccncc2s1.
What is the InChIKey of [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate?
The InChIKey is LBRVLUOTHLSLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O6S/c29-23(27-24-14-20-8-10-26-15-22(20)35-24)13-18-4-6-19(7-5-18)16-33-25(30)21-3-1-2-17(12-21)9-11-34-28(31)32/h1-8,10,12,14-15H,9,11,13,16H2,(H,27,29).
What are the key properties of [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate?
[4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate has a molecular weight of 491.53 g/mol, XLogP of 4.59, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-oxo-2-(thieno[2,3-c]pyridin-2-ylamino)ethyl]phenyl]methyl 3-(2-nitrooxyethyl)benzoate is sourced from PubChem (CID 166810795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).