C24H27N5O9S — CID 162346477
[4-[(1S,2S)-3-amino-1-hydroxy-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 3,3-bis(nitrooxymethyl)cyclobutane-1-carboxylate (PubChem CID 162346477) has the molecular formula C24H27N5O9S and a molecular weight of 561.57 g/mol. Its IUPAC name is [4-[(1S,2S)-3-amino-1-hydroxy-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 3,3-bis(nitrooxymethyl)cyclobutane-1-carboxylate.
| Compound Name | [4-[(1S,2S)-3-amino-1-hydroxy-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 3,3-bis(nitrooxymethyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 162346477 |
| Molecular Formula | C24H27N5O9S |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | [4-[(1S,2S)-3-amino-1-hydroxy-1-(thieno[2,3-c]pyridin-2-ylamino)propan-2-yl]phenyl]methyl 3,3-bis(nitrooxymethyl)cyclobutane-1-carboxylate |
| SMILES | NC[C@H](c1ccc(COC(=O)C2CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])C2)cc1)[C@H](O)Nc1cc2ccncc2s1 |
| InChI | InChI=1S/C24H27N5O9S/c25-10-19(22(30)27-21-7-17-5-6-26-11-20(17)39-21)16-3-1-15(2-4-16)12-36-23(31)18-8-24(9-18,13-37-28(32)33)14-38-29(34)35/h1-7,11,18-19,22,27,30H,8-10,12-14,25H2/t19-,22+/m1/s1 |
| InChIKey | TZNILILIOXACGK-KNQAVFIVSA-N |
| XLogP | 2.63 |
| TPSA | 202.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|