C20H21ClN6O3S2 — CID 162353811
(4-chlorophenyl)-[3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-8-(2-methylsulfonylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone (PubChem CID 162353811) has the molecular formula C20H21ClN6O3S2 and a molecular weight of 493.01 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-8-(2-methylsulfonylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone.
| Compound Name | (4-chlorophenyl)-[3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-8-(2-methylsulfonylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 162353811 |
| Molecular Formula | C20H21ClN6O3S2 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | (4-chlorophenyl)-[3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-8-(2-methylsulfonylethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methanone |
| SMILES | CS(=O)(=O)CCC1c2nnc(-c3nc(C4CC4)ns3)n2CCN1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN6O3S2/c1-32(29,30)11-8-15-17-23-24-18(19-22-16(25-31-19)12-2-3-12)27(17)10-9-26(15)20(28)13-4-6-14(21)7-5-13/h4-7,12,15H,2-3,8-11H2,1H3 |
| InChIKey | VPQMUBLOVALUEH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |