About (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole
(4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole (PubChem CID 162362030) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole.
Molecular Properties
| Compound Name | (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole |
| PubChem CID | 162362030 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole |
| SMILES | C=c1[nH]c(C)c(C)/c1=C\C |
| InChI | InChI=1S/C9H13N/c1-5-9-6(2)7(3)10-8(9)4/h5,10H,4H2,1-3H3/b9-5+ |
| InChIKey | ZSUHSBCOYVCGSE-WEVVVXLNSA-N |
| XLogP | 0.84 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole?
The IUPAC name of (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole (CID 162362030) is (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole.
What is the SMILES notation for (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole?
The canonical SMILES for (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole is C=c1[nH]c(C)c(C)/c1=C\C.
What is the InChIKey of (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole?
The InChIKey is ZSUHSBCOYVCGSE-WEVVVXLNSA-N. The full InChI is InChI=1S/C9H13N/c1-5-9-6(2)7(3)10-8(9)4/h5,10H,4H2,1-3H3/b9-5+.
What are the key properties of (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole?
(4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole has a molecular weight of 135.21 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-ethylidene-2,3-dimethyl-5-methylidene-1H-pyrrole is sourced from PubChem (CID 162362030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).