C24H39NaO7 — CID 162373575
sodium (Z)-18-[(2R)-2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]octadec-9-enoate (PubChem CID 162373575) has the molecular formula C24H39NaO7 and a molecular weight of 462.56 g/mol. Its IUPAC name is sodium (Z)-18-[(2R)-2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]octadec-9-enoate.
| Compound Name | sodium (Z)-18-[(2R)-2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]octadec-9-enoate |
|---|---|
| PubChem CID | 162373575 |
| Molecular Formula | C24H39NaO7 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | sodium (Z)-18-[(2R)-2-(1,2-dihydroxyethyl)-4-hydroxy-5-oxo-2H-furan-3-yl]octadec-9-enoate |
| SMILES | O=C([O-])CCCCCCC/C=C\CCCCCCCCC1=C(O)C(=O)O[C@H]1C(O)CO.[Na+] |
| InChI | InChI=1S/C24H40O7.Na/c25-18-20(26)23-19(22(29)24(30)31-23)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-21(27)28;/h1,3,20,23,25-26,29H,2,4-18H2,(H,27,28);/q;+1/p-1/b3-1-;/t20?,23-;/m1./s1 |
| InChIKey | MEWUOQPYZHTCHE-IIUZIWSVSA-M |
| XLogP | 0.24 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|