C28H45NaO7 — CID 170167689
sodium (Z)-18-[4-hydroxy-5-oxo-2-(2-propan-2-yl-1,3-dioxolan-4-yl)-2H-furan-3-yl]octadec-9-enoate (PubChem CID 170167689) has the molecular formula C28H45NaO7 and a molecular weight of 516.65 g/mol. Its IUPAC name is sodium (Z)-18-[4-hydroxy-5-oxo-2-(2-propan-2-yl-1,3-dioxolan-4-yl)-2H-furan-3-yl]octadec-9-enoate.
| Compound Name | sodium (Z)-18-[4-hydroxy-5-oxo-2-(2-propan-2-yl-1,3-dioxolan-4-yl)-2H-furan-3-yl]octadec-9-enoate |
|---|---|
| PubChem CID | 170167689 |
| Molecular Formula | C28H45NaO7 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | sodium (Z)-18-[4-hydroxy-5-oxo-2-(2-propan-2-yl-1,3-dioxolan-4-yl)-2H-furan-3-yl]octadec-9-enoate |
| SMILES | CC(C)C1OCC(C2OC(=O)C(O)=C2CCCCCCCC/C=C\CCCCCCCC(=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C28H46O7.Na/c1-21(2)28-33-20-23(34-28)26-22(25(31)27(32)35-26)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-24(29)30;/h3,5,21,23,26,28,31H,4,6-20H2,1-2H3,(H,29,30);/q;+1/p-1/b5-3-; |
| InChIKey | XZLZFZACTKJQBE-FBZPGIPVSA-M |
| XLogP | 2.28 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|