C15H18N5O2Si — CID 162381392
CID 162381392 (PubChem CID 162381392) has the molecular formula C15H18N5O2Si and a molecular weight of 328.43 g/mol.
| Compound Name | CID 162381392 |
|---|---|
| PubChem CID | 162381392 |
| Molecular Formula | C15H18N5O2Si |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | — |
| SMILES | C#Cc1nn([C@@]2([Si])C[C@H](C)N(C(=O)C=C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C15H18N5O2Si/c1-5-10-12(13(16)22)14(17-4)20(18-10)15(23)7-9(3)19(8-15)11(21)6-2/h1,6,9,17H,2,7-8H2,3-4H3,(H2,16,22)/t9-,15+/m0/s1 |
| InChIKey | FLTVDLCGYZWCLN-BJOHPYRUSA-N |
| XLogP | -0.37 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|