C13H18F2N2O3 — CID 162387338
N-[2-(2,6-difluoro-4-hydroxyphenyl)ethyl]-4-oxobutanamide;methanamine (PubChem CID 162387338) has the molecular formula C13H18F2N2O3 and a molecular weight of 288.29 g/mol. Its IUPAC name is N-[2-(2,6-difluoro-4-hydroxyphenyl)ethyl]-4-oxobutanamide;methanamine.
| Compound Name | N-[2-(2,6-difluoro-4-hydroxyphenyl)ethyl]-4-oxobutanamide;methanamine |
|---|---|
| PubChem CID | 162387338 |
| Molecular Formula | C13H18F2N2O3 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N-[2-(2,6-difluoro-4-hydroxyphenyl)ethyl]-4-oxobutanamide;methanamine |
| SMILES | CN.O=CCCC(=O)NCCc1c(F)cc(O)cc1F |
| InChI | InChI=1S/C12H13F2NO3.CH5N/c13-10-6-8(17)7-11(14)9(10)3-4-15-12(18)2-1-5-16;1-2/h5-7,17H,1-4H2,(H,15,18);2H2,1H3 |
| InChIKey | WMUULGZWQQSMKO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|