C15H19NO2S — CID 162405755
2-[(2Z)-3-ethyl-2-[hydroxy(phenyl)methylidene]-4-methyl-1,3-thiazol-5-yl]ethanol (PubChem CID 162405755) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(2Z)-3-ethyl-2-[hydroxy(phenyl)methylidene]-4-methyl-1,3-thiazol-5-yl]ethanol.
| Compound Name | 2-[(2Z)-3-ethyl-2-[hydroxy(phenyl)methylidene]-4-methyl-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 162405755 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(2Z)-3-ethyl-2-[hydroxy(phenyl)methylidene]-4-methyl-1,3-thiazol-5-yl]ethanol |
| SMILES | CCN1C(C)=C(CCO)S/C1=C(\O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO2S/c1-3-16-11(2)13(9-10-17)19-15(16)14(18)12-7-5-4-6-8-12/h4-8,17-18H,3,9-10H2,1-2H3/b15-14- |
| InChIKey | WSVXEMVJQQXBAO-PFONDFGASA-N |
| XLogP | 3.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|