C21H21NO3S — CID 162413069
4-[(7-phenylmethoxy-3,4-dihydronaphthalen-2-yl)sulfonyl]butanenitrile (PubChem CID 162413069) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is 4-[(7-phenylmethoxy-3,4-dihydronaphthalen-2-yl)sulfonyl]butanenitrile.
| Compound Name | 4-[(7-phenylmethoxy-3,4-dihydronaphthalen-2-yl)sulfonyl]butanenitrile |
|---|---|
| PubChem CID | 162413069 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[(7-phenylmethoxy-3,4-dihydronaphthalen-2-yl)sulfonyl]butanenitrile |
| SMILES | N#CCCCS(=O)(=O)C1=Cc2cc(OCc3ccccc3)ccc2CC1 |
| InChI | InChI=1S/C21H21NO3S/c22-12-4-5-13-26(23,24)21-11-9-18-8-10-20(14-19(18)15-21)25-16-17-6-2-1-3-7-17/h1-3,6-8,10,14-15H,4-5,9,11,13,16H2 |
| InChIKey | DLQWRHKVMWHRFP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|