C26H43NO6Si — CID 162417431
methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4,4-dimethylpentanoate (PubChem CID 162417431) has the molecular formula C26H43NO6Si and a molecular weight of 493.72 g/mol. Its IUPAC name is methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4,4-dimethylpentanoate.
| Compound Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 162417431 |
| Molecular Formula | C26H43NO6Si |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | methyl (3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[dimethyl(phenyl)silyl]-4,4-dimethylpentanoate |
| SMILES | COC(=O)C([C@@H](C(C)(C)C)[Si](C)(C)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43NO6Si/c1-24(2,3)20(34(11,12)18-16-14-13-15-17-18)19(21(28)31-10)27(22(29)32-25(4,5)6)23(30)33-26(7,8)9/h13-17,19-20H,1-12H3/t19?,20-/m0/s1 |
| InChIKey | QMYSAXHFDYMMBT-ANYOKISRSA-N |
| XLogP | 5.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|