C25H28ClNO — CID 162419889
(12R,13R,15S)-13-chloro-12-ethenyl-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9,11(16)-hexaen-15-ol (PubChem CID 162419889) has the molecular formula C25H28ClNO and a molecular weight of 393.96 g/mol. Its IUPAC name is (12R,13R,15S)-13-chloro-12-ethenyl-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9,11(16)-hexaen-15-ol.
| Compound Name | (12R,13R,15S)-13-chloro-12-ethenyl-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9,11(16)-hexaen-15-ol |
|---|---|
| PubChem CID | 162419889 |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (12R,13R,15S)-13-chloro-12-ethenyl-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9,11(16)-hexaen-15-ol |
| SMILES | C=C[C@]1(C)C2=C3c4c([nH]c5cccc(c45)C(C)(C)[C@@]3(O)C[C@H]1Cl)C(C)(C)C=C2 |
| InChI | InChI=1S/C25H28ClNO/c1-7-24(6)15-11-12-22(2,3)21-19-18-14(9-8-10-16(18)27-21)23(4,5)25(28,20(15)19)13-17(24)26/h7-12,17,27-28H,1,13H2,2-6H3/t17-,24-,25-/m1/s1 |
| InChIKey | LQADTEZKUKDYTL-LJXNEXSDSA-N |
| XLogP | 5.99 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|