C30H39BrF3N5O3Si — CID 162423540
tert-butyl 2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 162423540) has the molecular formula C30H39BrF3N5O3Si and a molecular weight of 682.66 g/mol. Its IUPAC name is tert-butyl 2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl 2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 162423540 |
| Molecular Formula | C30H39BrF3N5O3Si |
| Molecular Weight | 682.66 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | tert-butyl 2-[[4-[6-bromo-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(Nc1ncc(C(F)(F)F)c(-c3cn(COCC[Si](C)(C)C)c4cc(Br)ccc34)n1)C2 |
| InChI | InChI=1S/C30H39BrF3N5O3Si/c1-29(2,3)42-28(40)39-19-8-10-24(39)23(14-19)36-27-35-15-22(30(32,33)34)26(37-27)21-16-38(17-41-11-12-43(4,5)6)25-13-18(31)7-9-20(21)25/h7,9,13,15-16,19,23-24H,8,10-12,14,17H2,1-6H3,(H,35,36,37) |
| InChIKey | GIJCFQLTYXCKQR-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.66 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|