C36H49N5O6S — CID 162435950
methyl 3-(3-tert-butylsulfanyloxypropyl)-6-ethyl-7-[3-[(5-formyl-1-methylpyrazol-3-yl)methoxymethyl]-5-methyl-1-(oxan-2-yl)pyrazol-4-yl]-1-methylindole-2-carboxylate (PubChem CID 162435950) has the molecular formula C36H49N5O6S and a molecular weight of 679.88 g/mol. Its IUPAC name is methyl 3-(3-tert-butylsulfanyloxypropyl)-6-ethyl-7-[3-[(5-formyl-1-methylpyrazol-3-yl)methoxymethyl]-5-methyl-1-(oxan-2-yl)pyrazol-4-yl]-1-methylindole-2-carboxylate.
| Compound Name | methyl 3-(3-tert-butylsulfanyloxypropyl)-6-ethyl-7-[3-[(5-formyl-1-methylpyrazol-3-yl)methoxymethyl]-5-methyl-1-(oxan-2-yl)pyrazol-4-yl]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 162435950 |
| Molecular Formula | C36H49N5O6S |
| Molecular Weight | 679.88 g/mol |
| Exact Mass | 679.34 |
| IUPAC Name | methyl 3-(3-tert-butylsulfanyloxypropyl)-6-ethyl-7-[3-[(5-formyl-1-methylpyrazol-3-yl)methoxymethyl]-5-methyl-1-(oxan-2-yl)pyrazol-4-yl]-1-methylindole-2-carboxylate |
| SMILES | CCc1ccc2c(CCCOSC(C)(C)C)c(C(=O)OC)n(C)c2c1-c1c(COCc2cc(C=O)n(C)n2)nn(C2CCCCO2)c1C |
| InChI | InChI=1S/C36H49N5O6S/c1-9-24-15-16-28-27(13-12-18-47-48-36(3,4)5)34(35(43)44-8)39(6)33(28)32(24)31-23(2)41(30-14-10-11-17-46-30)38-29(31)22-45-21-25-19-26(20-42)40(7)37-25/h15-16,19-20,30H,9-14,17-18,21-22H2,1-8H3 |
| InChIKey | YVGCKDIKZKKTJJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.88 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|