C37H46Cl2NORu- — CID 162436219
dichloro-[(2-propoxyphenyl)methylidene]ruthenium;(4R)-2,2,4-trimethyl-4-naphthalen-1-yl-1-[(3Z,5Z)-3-propylhepta-1,3,5-trien-2-yl]pyrrolidin-5-ide (PubChem CID 162436219) has the molecular formula C37H46Cl2NORu- and a molecular weight of 692.76 g/mol. Its IUPAC name is dichloro-[(2-propoxyphenyl)methylidene]ruthenium;(4R)-2,2,4-trimethyl-4-naphthalen-1-yl-1-[(3Z,5Z)-3-propylhepta-1,3,5-trien-2-yl]pyrrolidin-5-ide.
| Compound Name | dichloro-[(2-propoxyphenyl)methylidene]ruthenium;(4R)-2,2,4-trimethyl-4-naphthalen-1-yl-1-[(3Z,5Z)-3-propylhepta-1,3,5-trien-2-yl]pyrrolidin-5-ide |
|---|---|
| PubChem CID | 162436219 |
| Molecular Formula | C37H46Cl2NORu- |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.20 |
| IUPAC Name | dichloro-[(2-propoxyphenyl)methylidene]ruthenium;(4R)-2,2,4-trimethyl-4-naphthalen-1-yl-1-[(3Z,5Z)-3-propylhepta-1,3,5-trien-2-yl]pyrrolidin-5-ide |
| SMILES | C=C(/C(=C\C=C/C)CCC)N1[CH-][C@@](C)(c2cccc3ccccc23)CC1(C)C.CCCOc1ccccc1C=[Ru](Cl)Cl |
| InChI | InChI=1S/C27H34N.C10H12O.2ClH.Ru/c1-7-9-14-22(13-8-2)21(3)28-20-27(6,19-26(28,4)5)25-18-12-16-23-15-10-11-17-24(23)25;1-3-8-11-10-7-5-4-6-9(10)2;;;/h7,9-12,14-18,20H,3,8,13,19H2,1-2,4-6H3;2,4-7H,3,8H2,1H3;2*1H;/q-1;;;;+2/p-2/b9-7-,22-14-;;;;/t27-;;;;/m0..../s1 |
| InChIKey | WSURIZUGELTUCS-FKSKRXKESA-L |
| XLogP | 11.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|