C21H26F2N2O4 — CID 162437553
N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[6-(2-hydroxypropan-2-yl)-4-methoxy-2-pyridinyl]formamide (PubChem CID 162437553) has the molecular formula C21H26F2N2O4 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[6-(2-hydroxypropan-2-yl)-4-methoxy-2-pyridinyl]formamide.
| Compound Name | N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[6-(2-hydroxypropan-2-yl)-4-methoxy-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 162437553 |
| Molecular Formula | C21H26F2N2O4 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[6-(2-hydroxypropan-2-yl)-4-methoxy-2-pyridinyl]formamide |
| SMILES | CCC(CN(C=O)c1cc(OC)cc(C(C)(C)O)n1)c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C21H26F2N2O4/c1-6-13(20-16(22)7-14(28-4)8-17(20)23)11-25(12-26)19-10-15(29-5)9-18(24-19)21(2,3)27/h7-10,12-13,27H,6,11H2,1-5H3 |
| InChIKey | KEWGCKIMUCOCOL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|