C21H24F3NO3 — CID 162437964
N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[3-fluoro-5-(2-hydroxypropan-2-yl)phenyl]formamide (PubChem CID 162437964) has the molecular formula C21H24F3NO3 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[3-fluoro-5-(2-hydroxypropan-2-yl)phenyl]formamide.
| Compound Name | N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[3-fluoro-5-(2-hydroxypropan-2-yl)phenyl]formamide |
|---|---|
| PubChem CID | 162437964 |
| Molecular Formula | C21H24F3NO3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-[2-(2,6-difluoro-4-methoxyphenyl)butyl]-N-[3-fluoro-5-(2-hydroxypropan-2-yl)phenyl]formamide |
| SMILES | CCC(CN(C=O)c1cc(F)cc(C(C)(C)O)c1)c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C21H24F3NO3/c1-5-13(20-18(23)9-17(28-4)10-19(20)24)11-25(12-26)16-7-14(21(2,3)27)6-15(22)8-16/h6-10,12-13,27H,5,11H2,1-4H3 |
| InChIKey | LCRMRULKQVFVQN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|