C18H22FN3O3 — CID 162439920
tert-butyl N-[4-cyano-2-fluoro-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]carbamate (PubChem CID 162439920) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is tert-butyl N-[4-cyano-2-fluoro-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-cyano-2-fluoro-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 162439920 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | tert-butyl N-[4-cyano-2-fluoro-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(N2CC3CCC(C2)O3)c(C#N)cc1F |
| InChI | InChI=1S/C18H22FN3O3/c1-18(2,3)25-17(23)21-15-7-16(11(8-20)6-14(15)19)22-9-12-4-5-13(10-22)24-12/h6-7,12-13H,4-5,9-10H2,1-3H3,(H,21,23) |
| InChIKey | OCDARGFJTYQJAT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |