C17H13F7N2O3S2 — CID 162442587
5-[5-(1,1-difluoroethyl)-3-ethylsulfonyl-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)-4H-thieno[2,3-c]pyrrol-6-one (PubChem CID 162442587) has the molecular formula C17H13F7N2O3S2 and a molecular weight of 490.42 g/mol. Its IUPAC name is 5-[5-(1,1-difluoroethyl)-3-ethylsulfonyl-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)-4H-thieno[2,3-c]pyrrol-6-one.
| Compound Name | 5-[5-(1,1-difluoroethyl)-3-ethylsulfonyl-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)-4H-thieno[2,3-c]pyrrol-6-one |
|---|---|
| PubChem CID | 162442587 |
| Molecular Formula | C17H13F7N2O3S2 |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 5-[5-(1,1-difluoroethyl)-3-ethylsulfonyl-2-pyridinyl]-2-(1,1,2,2,2-pentafluoroethyl)-4H-thieno[2,3-c]pyrrol-6-one |
| SMILES | CCS(=O)(=O)c1cc(C(C)(F)F)cnc1N1Cc2cc(C(F)(F)C(F)(F)F)sc2C1=O |
| InChI | InChI=1S/C17H13F7N2O3S2/c1-3-31(28,29)10-5-9(15(2,18)19)6-25-13(10)26-7-8-4-11(30-12(8)14(26)27)16(20,21)17(22,23)24/h4-6H,3,7H2,1-2H3 |
| InChIKey | BNQYGSIZKYAFEH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|