C14H17N3O3S — CID 162442815
(2S,4S)-5-(1,3-benzothiazol-2-yl)-2-ethyl-4-(hydroxyamino)-5-oxopentanamide (PubChem CID 162442815) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is (2S,4S)-5-(1,3-benzothiazol-2-yl)-2-ethyl-4-(hydroxyamino)-5-oxopentanamide.
| Compound Name | (2S,4S)-5-(1,3-benzothiazol-2-yl)-2-ethyl-4-(hydroxyamino)-5-oxopentanamide |
|---|---|
| PubChem CID | 162442815 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2S,4S)-5-(1,3-benzothiazol-2-yl)-2-ethyl-4-(hydroxyamino)-5-oxopentanamide |
| SMILES | CC[C@@H](C[C@H](NO)C(=O)c1nc2ccccc2s1)C(N)=O |
| InChI | InChI=1S/C14H17N3O3S/c1-2-8(13(15)19)7-10(17-20)12(18)14-16-9-5-3-4-6-11(9)21-14/h3-6,8,10,17,20H,2,7H2,1H3,(H2,15,19)/t8-,10-/m0/s1 |
| InChIKey | OKNGJYCRLBNVAW-WPRPVWTQSA-N |
| XLogP | 1.73 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|