C17H28N8O11P2 — CID 162449954
[[5-(6-aminopurin-9-yl)-4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 162449954) has the molecular formula C17H28N8O11P2 and a molecular weight of 582.40 g/mol. Its IUPAC name is [[5-(6-aminopurin-9-yl)-4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[5-(6-aminopurin-9-yl)-4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 162449954 |
| Molecular Formula | C17H28N8O11P2 |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 582.14 |
| IUPAC Name | [[5-(6-aminopurin-9-yl)-4-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOC1C(O)C(COP(=O)(O)CP(=O)(O)O)OC1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H28N8O11P2/c18-15-12-16(21-8-20-15)25(9-22-12)17-14(34-6-5-33-4-3-32-2-1-23-24-19)13(26)11(36-17)7-35-38(30,31)10-37(27,28)29/h8-9,11,13-14,17,26H,1-7,10H2,(H,30,31)(H2,18,20,21)(H2,27,28,29) |
| InChIKey | HSJRDWBGZWOZDA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 279.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|