C11H11N3O2 — CID 162457713
7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 162457713) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 162457713 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 7-[(1R,4S)-4-hydroxycyclopent-2-en-1-yl]-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1ccn2[C@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C11H11N3O2/c15-8-2-1-7(5-8)14-4-3-9-10(14)12-6-13-11(9)16/h1-4,6-8,15H,5H2,(H,12,13,16)/t7-,8+/m0/s1 |
| InChIKey | YKRZKOKEGOLOCI-JGVFFNPUSA-N |
| XLogP | 0.59 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|