C25H25F2N3O4Si — CID 162469792
6-(2,2-difluoroethoxy)-2-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile (PubChem CID 162469792) has the molecular formula C25H25F2N3O4Si and a molecular weight of 497.57 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-2-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile.
| Compound Name | 6-(2,2-difluoroethoxy)-2-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 162469792 |
| Molecular Formula | C25H25F2N3O4Si |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-2-[(Z)-(3-oxo-2-benzofuran-1-ylidene)methyl]-3-(2-trimethylsilylethoxymethyl)benzimidazole-5-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(/C=C2\OC(=O)c3ccccc32)nc2cc(OCC(F)F)c(C#N)cc21 |
| InChI | InChI=1S/C25H25F2N3O4Si/c1-35(2,3)9-8-32-15-30-20-10-16(13-28)21(33-14-23(26)27)11-19(20)29-24(30)12-22-17-6-4-5-7-18(17)25(31)34-22/h4-7,10-12,23H,8-9,14-15H2,1-3H3/b22-12- |
| InChIKey | ZFCQLCHMHICUHK-UUYOSTAYSA-N |
| XLogP | 5.53 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|