C15H21BNO7PS — CID 162479746
CID 162479746 (PubChem CID 162479746) has the molecular formula C15H21BNO7PS and a molecular weight of 401.19 g/mol.
| Compound Name | CID 162479746 |
|---|---|
| PubChem CID | 162479746 |
| Molecular Formula | C15H21BNO7PS |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC[C@@H](COP(=O)(O)SCOC(=O)OCc2ccc(NC)cc2)O1 |
| InChI | InChI=1S/C15H21BNO7PS/c1-17-12-4-2-11(3-5-12)8-21-15(18)22-10-26-25(19,20)23-9-13-6-7-14(16)24-13/h2-5,13-14,17H,6-10H2,1H3,(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | ZBZGVKMUCIXSGD-UONOGXRCSA-N |
| XLogP | 2.86 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|