C13H18BO4PSW — CID 162479750
CID 162479750 (PubChem CID 162479750) has the molecular formula C13H18BO4PSW and a molecular weight of 495.98 g/mol.
| Compound Name | CID 162479750 |
|---|---|
| PubChem CID | 162479750 |
| Molecular Formula | C13H18BO4PSW |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC[C@@H](COP(=O)(O)SCc2cc[c-]cc2)O1.[CH3-].[W+2] |
| InChI | InChI=1S/C12H15BO4PS.CH3.W/c13-12-7-6-11(17-12)8-16-18(14,15)19-9-10-4-2-1-3-5-10;;/h2-5,11-12H,6-9H2,(H,14,15);1H3;/q2*-1;+2/t11-,12+;;/m0../s1 |
| InChIKey | CZULSGRJEXOJDF-UVDYRLMLSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|